Benzenesulfonic acid, 2-(1-methylethenyl)-, sodium salt
CAS No: 79347-33-4
79347-73-2
alpha,gamma,4-trimethylcyclohex-3-ene-1-butyraldehyde
93776-17-1
[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxytridecan-1-yl][bis(2-hydroxyethyl)]methylammonium iodide
79347-67-4
3-Furancarbonylchloride, 5-(chloromethyl)-2-methyl-
93776-02-4
1,1-[oxybis(propyleneoxy)]bis[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecan-2-ol]
79349-14-7
Benzenamine, 4-[2-(diphenylphosphinothioyl)ethenyl]-N,N-dimethyl-,(E)-
93776-19-3
Bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,18,18,18-dotriacontafluoro-17-(trifluoromethyl)octadecyl) hydrogen phosphate
93775-75-8
1H-Naphth[2,3-f]isoindole-1,3,5,10(2H)-tetrone,4,11-diamino-2-(3-hydroxypropyl)-
79344-67-5
2,4(1H,3H)-Pyrimidinedione, 6-[(4-nitrophenyl)amino]-
93773-64-9
1H-Indole, 3-(2-propyl-5-oxazolyl)-
846049-77-2
L-Cysteine, L-seryl-L-prolyl-L-a-aspartylglycyl-L-lysyl-L-prolyl-
93772-50-0
2,6,10,14,18,22,26,30,34,38-Tetracontadecaenoic acid,3,7,11,15,19,23,27,31,35,39-decamethyl-, sodium salt
937-73-5
2(1H)-Pyrimidinethione, tetrahydro-4-hydroxy-4,6,6-trimethyl-
79343-59-2
2H-Indol-2-one, 1-acetyl-3-(dicyanomethylene)-1,3-dihydro-
79352-95-7
1H-Isoindole-1,3(2H)-dione,2-[2-[(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)methoxy]ethyl]-
93776-05-7
1,1-[oxybis(propyleneoxy)]bis[4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-(trifluoromethyl)undecan-2-ol]
79347-33-4
Benzenesulfonic acid, 2-(1-methylethenyl)-, sodium salt
93775-03-2
1-Decene, 1-methoxy-, (1Z)-
79354-51-1
Acetic acid, [(4-bromophenyl)amino]oxo-
79343-93-4
Pyridinium, 2-bromo-1-ethyl-, bromide
79345-75-8
Phosphine, phenylbis(3-phosphinopropyl)-
79347-33-4
benzenesulfonic,methylethenyl,sodium,79347-33-4
2025-10-17 Discover Benzenesulfonic acid, 2-(1-methylethenyl)-, sodium salt (CAS No: 79347-33-4) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.